C33H45N3O5 — CID 150478459
1-[(2S,3R)-4-[(2,4-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150478459) has the molecular formula C33H45N3O5 and a molecular weight of 563.74 g/mol. Its IUPAC name is 1-[(2S,3R)-4-[(2,4-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-[(2,4-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150478459 |
| Molecular Formula | C33H45N3O5 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | 1-[(2S,3R)-4-[(2,4-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccccc2)[C@@H](O)CNCc2ccc(OC)cc2OC)C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C33H45N3O5/c1-5-17-36(18-6-2)32(39)33(16-10-13-25(21-33)31(34)38)28(19-24-11-8-7-9-12-24)29(37)23-35-22-26-14-15-27(40-3)20-30(26)41-4/h7-16,20,28-29,35,37H,5-6,17-19,21-23H2,1-4H3,(H2,34,38)/t28-,29+,33?/m1/s1 |
| InChIKey | HTHKEEFNDLZTPO-GIILZSEGSA-N |
| XLogP | 4.02 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |