C34H47N3O6 — CID 154452446
1-[(2S,3R)-3-hydroxy-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154452446) has the molecular formula C34H47N3O6 and a molecular weight of 593.77 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxy-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-3-hydroxy-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452446 |
| Molecular Formula | C34H47N3O6 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxy-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccccc2)[C@@H](O)CNCc2cc(OC)c(OC)c(OC)c2)C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C34H47N3O6/c1-6-16-37(17-7-2)33(40)34(15-11-14-26(21-34)32(35)39)27(18-24-12-9-8-10-13-24)28(38)23-36-22-25-19-29(41-3)31(43-5)30(20-25)42-4/h8-15,19-20,27-28,36,38H,6-7,16-18,21-23H2,1-5H3,(H2,35,39)/t27-,28+,34?/m1/s1 |
| InChIKey | OHHKFBHQHDJADQ-ITXNJQJZSA-N |
| XLogP | 4.03 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |