C29H43N3O4 — CID 154452492
1-[(2S,3R)-3-hydroxy-4-(oxolan-2-ylmethylamino)-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154452492) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxy-4-(oxolan-2-ylmethylamino)-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-3-hydroxy-4-(oxolan-2-ylmethylamino)-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452492 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxy-4-(oxolan-2-ylmethylamino)-1-phenylbutan-2-yl]-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccccc2)[C@@H](O)CNCC2CCCO2)C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C29H43N3O4/c1-3-15-32(16-4-2)28(35)29(14-8-12-23(19-29)27(30)34)25(18-22-10-6-5-7-11-22)26(33)21-31-20-24-13-9-17-36-24/h5-8,10-12,14,24-26,31,33H,3-4,9,13,15-21H2,1-2H3,(H2,30,34)/t24?,25-,26+,29?/m1/s1 |
| InChIKey | NBRNBWRWGOISKB-FPWWFTSNSA-N |
| XLogP | 2.98 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |