C36H51N3O3 — CID 154452471
1-[(2S,3R)-4-[3-(2,4-dimethylphenyl)propylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154452471) has the molecular formula C36H51N3O3 and a molecular weight of 573.82 g/mol. Its IUPAC name is 1-[(2S,3R)-4-[3-(2,4-dimethylphenyl)propylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-[3-(2,4-dimethylphenyl)propylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452471 |
| Molecular Formula | C36H51N3O3 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.39 |
| IUPAC Name | 1-[(2S,3R)-4-[3-(2,4-dimethylphenyl)propylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccccc2)[C@@H](O)CNCCCc2ccc(C)cc2C)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C36H51N3O3/c1-6-18-39(19-7-2)35(42)36(23-27(4)21-31(24-36)34(37)41)32(22-29-12-9-8-10-13-29)33(40)25-38-17-11-14-30-16-15-26(3)20-28(30)5/h8-10,12-13,15-16,20-21,23,32-33,38,40H,6-7,11,14,17-19,22,24-25H2,1-5H3,(H2,37,41)/t32-,33+,36?/m1/s1 |
| InChIKey | FLRBBVOLWROFEN-BBZLWSGTSA-N |
| XLogP | 5.44 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|