C34H45F2N3O4 — CID 152744572
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-hydroxy-1-phenylpropyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 152744572) has the molecular formula C34H45F2N3O4 and a molecular weight of 597.75 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-hydroxy-1-phenylpropyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-hydroxy-1-phenylpropyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152744572 |
| Molecular Formula | C34H45F2N3O4 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-hydroxy-1-phenylpropyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNC(CCO)c2ccccc2)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C34H45F2N3O4/c1-4-12-39(13-5-2)33(43)34(20-23(3)15-26(21-34)32(37)42)29(18-24-16-27(35)19-28(36)17-24)31(41)22-38-30(11-14-40)25-9-7-6-8-10-25/h6-10,15-17,19-20,29-31,38,40-41H,4-5,11-14,18,21-22H2,1-3H3,(H2,37,42)/t29-,30?,31+,34?/m1/s1 |
| InChIKey | YIOTUGWKXOREJI-VSBJZTRTSA-N |
| XLogP | 4.59 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |