C35H45F2N3O3 — CID 151142822
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methylphenyl)cyclopropyl]amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 151142822) has the molecular formula C35H45F2N3O3 and a molecular weight of 593.76 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methylphenyl)cyclopropyl]amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methylphenyl)cyclopropyl]amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 151142822 |
| Molecular Formula | C35H45F2N3O3 |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methylphenyl)cyclopropyl]amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C)=CC(C(N)=O)([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNC2(c3cccc(C)c3)CC2)C1 |
| InChI | InChI=1S/C35H45F2N3O3/c1-5-12-40(13-6-2)32(42)26-14-24(4)20-34(21-26,33(38)43)30(18-25-16-28(36)19-29(37)17-25)31(41)22-39-35(10-11-35)27-9-7-8-23(3)15-27/h7-9,14-17,19-20,30-31,39,41H,5-6,10-13,18,21-22H2,1-4H3,(H2,38,43)/t30-,31+,34?/m1/s1 |
| InChIKey | MWOGQBIZPPPNIX-LSABIWSESA-N |
| XLogP | 5.47 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |