C32H46F2N4O4 — CID 150300212
1-[(2S,3R)-4-[(1-carbamoylcyclohexyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150300212) has the molecular formula C32H46F2N4O4 and a molecular weight of 588.74 g/mol. Its IUPAC name is 1-[(2S,3R)-4-[(1-carbamoylcyclohexyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-[(1-carbamoylcyclohexyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150300212 |
| Molecular Formula | C32H46F2N4O4 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | 1-[(2S,3R)-4-[(1-carbamoylcyclohexyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C)=CC(C(N)=O)([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNC2(C(N)=O)CCCCC2)C1 |
| InChI | InChI=1S/C32H46F2N4O4/c1-4-11-38(12-5-2)28(40)23-13-21(3)18-31(19-23,29(35)41)26(16-22-14-24(33)17-25(34)15-22)27(39)20-37-32(30(36)42)9-7-6-8-10-32/h13-15,17-18,26-27,37,39H,4-12,16,19-20H2,1-3H3,(H2,35,41)(H2,36,42)/t26-,27+,31?/m1/s1 |
| InChIKey | GJLHVAUJEYGZNI-SCSQSSOESA-N |
| XLogP | 3.66 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |