C33H46ClF2N5O3 — CID 150272704
1-[(2S,3R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150272704) has the molecular formula C33H46ClF2N5O3 and a molecular weight of 634.21 g/mol. Its IUPAC name is 1-[(2S,3R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150272704 |
| Molecular Formula | C33H46ClF2N5O3 |
| Molecular Weight | 634.21 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | 1-[(2S,3R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCCc1nc(Cl)c(CNC[C@H](O)[C@@H](Cc2cc(F)cc(F)c2)C2(C(N)=O)C=C(C)C=C(C(=O)N(CCC)CCC)C2)[nH]1 |
| InChI | InChI=1S/C33H46ClF2N5O3/c1-5-8-9-29-39-27(30(34)40-29)19-38-20-28(42)26(15-22-13-24(35)16-25(36)14-22)33(32(37)44)17-21(4)12-23(18-33)31(43)41(10-6-2)11-7-3/h12-14,16-17,26,28,38,42H,5-11,15,18-20H2,1-4H3,(H2,37,44)(H,39,40)/t26-,28+,33?/m1/s1 |
| InChIKey | GDXGMWJCFPCAQG-UKZJIVIUSA-N |
| XLogP | 5.39 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |