C33H44ClN3O4 — CID 70145622
1-[(2S,3R)-1-(3-chlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 70145622) has the molecular formula C33H44ClN3O4 and a molecular weight of 582.19 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3-chlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3-chlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70145622 |
| Molecular Formula | C33H44ClN3O4 |
| Molecular Weight | 582.19 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 1-[(2S,3R)-1-(3-chlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C)=CC(C(N)=O)([C@H](Cc2cccc(Cl)c2)[C@@H](O)CNCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C33H44ClN3O4/c1-5-13-37(14-6-2)31(39)26-15-23(3)19-33(20-26,32(35)40)29(18-24-9-7-11-27(34)16-24)30(38)22-36-21-25-10-8-12-28(17-25)41-4/h7-12,15-17,19,29-30,36,38H,5-6,13-14,18,20-22H2,1-4H3,(H2,35,40)/t29-,30+,33?/m1/s1 |
| InChIKey | QNZRYJCARUBUTE-QRBFTZNISA-N |
| XLogP | 5.05 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.19 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |