C31H38F3N3O3 — CID 150765634
1-[(2S,3R)-4-(benzylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-fluoro-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150765634) has the molecular formula C31H38F3N3O3 and a molecular weight of 557.66 g/mol. Its IUPAC name is 1-[(2S,3R)-4-(benzylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-fluoro-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-(benzylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-fluoro-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150765634 |
| Molecular Formula | C31H38F3N3O3 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 1-[(2S,3R)-4-(benzylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-fluoro-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(F)=CC(C(N)=O)([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2ccccc2)C1 |
| InChI | InChI=1S/C31H38F3N3O3/c1-3-10-37(11-4-2)29(39)23-15-26(34)18-31(17-23,30(35)40)27(14-22-12-24(32)16-25(33)13-22)28(38)20-36-19-21-8-6-5-7-9-21/h5-9,12-13,15-16,18,27-28,36,38H,3-4,10-11,14,17,19-20H2,1-2H3,(H2,35,40)/t27-,28+,31?/m1/s1 |
| InChIKey | JYTOZZLAGXLNIF-HDYHSKNASA-N |
| XLogP | 4.58 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |