C34H42F2N4O3 — CID 150679312
1-[(2S,3R)-4-[benzyl(cyanomethyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150679312) has the molecular formula C34H42F2N4O3 and a molecular weight of 592.73 g/mol. Its IUPAC name is 1-[(2S,3R)-4-[benzyl(cyanomethyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-[benzyl(cyanomethyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150679312 |
| Molecular Formula | C34H42F2N4O3 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 1-[(2S,3R)-4-[benzyl(cyanomethyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C)=CC(C(N)=O)([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CN(CC#N)Cc2ccccc2)C1 |
| InChI | InChI=1S/C34H42F2N4O3/c1-4-12-40(13-5-2)32(42)27-15-24(3)20-34(21-27,33(38)43)30(18-26-16-28(35)19-29(36)17-26)31(41)23-39(14-11-37)22-25-9-7-6-8-10-25/h6-10,15-17,19-20,30-31,41H,4-5,12-14,18,21-23H2,1-3H3,(H2,38,43)/t30-,31+,34?/m1/s1 |
| InChIKey | JHNORLQJQFGKCU-LSABIWSESA-N |
| XLogP | 4.91 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|