C33H41F2N3O5 — CID 152744574
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxybenzoyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 152744574) has the molecular formula C33H41F2N3O5 and a molecular weight of 597.70 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxybenzoyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxybenzoyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152744574 |
| Molecular Formula | C33H41F2N3O5 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxybenzoyl)amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNC(=O)c2cccc(OC)c2)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C33H41F2N3O5/c1-5-10-38(11-6-2)32(42)33(18-21(3)12-24(19-33)30(36)40)28(15-22-13-25(34)17-26(35)14-22)29(39)20-37-31(41)23-8-7-9-27(16-23)43-4/h7-9,12-14,16-18,28-29,39H,5-6,10-11,15,19-20H2,1-4H3,(H2,36,40)(H,37,41)/t28-,29+,33?/m1/s1 |
| InChIKey | FYBCXHXJHGMYJV-GIILZSEGSA-N |
| XLogP | 4.32 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |