C29H43F2N3O3 — CID 154452395
1-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154452395) has the molecular formula C29H43F2N3O3 and a molecular weight of 519.68 g/mol. Its IUPAC name is 1-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452395 |
| Molecular Formula | C29H43F2N3O3 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | 1-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCCNC[C@H](O)[C@@H](Cc1cc(F)cc(F)c1)C1(C(=O)N(CCC)CCC)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C29H43F2N3O3/c1-5-8-9-33-19-26(35)25(15-21-13-23(30)16-24(31)14-21)29(28(37)34(10-6-2)11-7-3)17-20(4)12-22(18-29)27(32)36/h12-14,16-17,25-26,33,35H,5-11,15,18-19H2,1-4H3,(H2,32,36)/t25-,26+,29?/m1/s1 |
| InChIKey | DKKHOSGPXBCTDM-SSDKUHEVSA-N |
| XLogP | 4.27 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|