C35H50ClN3O3 — CID 159888990
1-[(2S,3R)-3-hydroxy-4-[3-(4-methylphenyl)propylamino]-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide;hydrochloride (PubChem CID 159888990) has the molecular formula C35H50ClN3O3 and a molecular weight of 596.26 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxy-4-[3-(4-methylphenyl)propylamino]-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide;hydrochloride.
| Compound Name | 1-[(2S,3R)-3-hydroxy-4-[3-(4-methylphenyl)propylamino]-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 159888990 |
| Molecular Formula | C35H50ClN3O3 |
| Molecular Weight | 596.26 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxy-4-[3-(4-methylphenyl)propylamino]-1-phenylbutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide;hydrochloride |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccccc2)[C@@H](O)CNCCCc2ccc(C)cc2)C=C(C)C=C(C(N)=O)C1.Cl |
| InChI | InChI=1S/C35H49N3O3.ClH/c1-5-19-38(20-6-2)34(41)35(23-27(4)21-30(24-35)33(36)40)31(22-29-11-8-7-9-12-29)32(39)25-37-18-10-13-28-16-14-26(3)15-17-28;/h7-9,11-12,14-17,21,23,31-32,37,39H,5-6,10,13,18-20,22,24-25H2,1-4H3,(H2,36,40);1H/t31-,32+,35?;/m1./s1 |
| InChIKey | OUHCTNMWILQSMT-ATSMAMERSA-N |
| XLogP | 5.56 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|