C33H43Cl2N3O4 — CID 154452433
1-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154452433) has the molecular formula C33H43Cl2N3O4 and a molecular weight of 616.63 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452433 |
| Molecular Formula | C33H43Cl2N3O4 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(Cl)cc(Cl)c2)[C@@H](O)CNCc2cccc(OC)c2)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C33H43Cl2N3O4/c1-5-10-38(11-6-2)32(41)33(18-22(3)12-25(19-33)31(36)40)29(16-24-13-26(34)17-27(35)14-24)30(39)21-37-20-23-8-7-9-28(15-23)42-4/h7-9,12-15,17-18,29-30,37,39H,5-6,10-11,16,19-21H2,1-4H3,(H2,36,40)/t29-,30+,33?/m1/s1 |
| InChIKey | XMPSAQORIGKPEU-QRBFTZNISA-N |
| XLogP | 5.71 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |