C29H42F2N4O4 — CID 152744578
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 152744578) has the molecular formula C29H42F2N4O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152744578 |
| Molecular Formula | C29H42F2N4O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CN[C@@H](C)C(=O)NC)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C29H42F2N4O4/c1-6-8-35(9-7-2)28(39)29(15-18(3)10-21(16-29)26(32)37)24(13-20-11-22(30)14-23(31)12-20)25(36)17-34-19(4)27(38)33-5/h10-12,14-15,19,24-25,34,36H,6-9,13,16-17H2,1-5H3,(H2,32,37)(H,33,38)/t19-,24+,25-,29?/m0/s1 |
| InChIKey | OLCHCKPGHFJUEO-RCRACHEZSA-N |
| XLogP | 2.61 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |