C27H33N3O8 — CID 151523595
[(2R,3R,4R,5R)-2-acetyl-5-(4-azido-1-phenylmethoxybutyl)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] acetate (PubChem CID 151523595) has the molecular formula C27H33N3O8 and a molecular weight of 527.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-acetyl-5-(4-azido-1-phenylmethoxybutyl)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-acetyl-5-(4-azido-1-phenylmethoxybutyl)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 151523595 |
| Molecular Formula | C27H33N3O8 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | [(2R,3R,4R,5R)-2-acetyl-5-(4-azido-1-phenylmethoxybutyl)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] acetate |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](C(CCCN=[N+]=[N-])OCc3ccccc3)O[C@@](O)(C(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C27H33N3O8/c1-18(31)27(33)26(37-19(2)32)25(36-17-21-11-13-22(34-3)14-12-21)24(38-27)23(10-7-15-29-30-28)35-16-20-8-5-4-6-9-20/h4-6,8-9,11-14,23-26,33H,7,10,15-17H2,1-3H3/t23?,24-,25-,26-,27+/m1/s1 |
| InChIKey | PUZAJLPFAXGOOJ-QAWYLDNLSA-N |
| XLogP | 3.86 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|