C24H33N3O5Si — CID 71482339
[(2S,3R,4R,5R)-5-[(1R)-2-azido-1-phenylmethoxyethyl]-2-methoxy-4-phenylmethoxyoxolan-3-yl]oxy-trimethylsilane (PubChem CID 71482339) has the molecular formula C24H33N3O5Si and a molecular weight of 471.63 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-[(1R)-2-azido-1-phenylmethoxyethyl]-2-methoxy-4-phenylmethoxyoxolan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3R,4R,5R)-5-[(1R)-2-azido-1-phenylmethoxyethyl]-2-methoxy-4-phenylmethoxyoxolan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 71482339 |
| Molecular Formula | C24H33N3O5Si |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(2S,3R,4R,5R)-5-[(1R)-2-azido-1-phenylmethoxyethyl]-2-methoxy-4-phenylmethoxyoxolan-3-yl]oxy-trimethylsilane |
| SMILES | CO[C@H]1O[C@H]([C@@H](CN=[N+]=[N-])OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C24H33N3O5Si/c1-28-24-23(32-33(2,3)4)22(30-17-19-13-9-6-10-14-19)21(31-24)20(15-26-27-25)29-16-18-11-7-5-8-12-18/h5-14,20-24H,15-17H2,1-4H3/t20-,21-,22-,23-,24+/m1/s1 |
| InChIKey | IASATERPMIWAFR-RMRNXIRCSA-N |
| XLogP | 5.06 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|