C21H26N3O5P — CID 11122890
(3S,4S,5S)-3-azido-2-methoxy-5-[1-[methoxy(phenyl)phosphoryl]ethyl]-4-phenylmethoxyoxolane (PubChem CID 11122890) has the molecular formula C21H26N3O5P and a molecular weight of 431.43 g/mol. Its IUPAC name is (3S,4S,5S)-3-azido-2-methoxy-5-[1-[methoxy(phenyl)phosphoryl]ethyl]-4-phenylmethoxyoxolane.
| Compound Name | (3S,4S,5S)-3-azido-2-methoxy-5-[1-[methoxy(phenyl)phosphoryl]ethyl]-4-phenylmethoxyoxolane |
|---|---|
| PubChem CID | 11122890 |
| Molecular Formula | C21H26N3O5P |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (3S,4S,5S)-3-azido-2-methoxy-5-[1-[methoxy(phenyl)phosphoryl]ethyl]-4-phenylmethoxyoxolane |
| SMILES | COC1O[C@H](C(C)P(=O)(OC)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C21H26N3O5P/c1-15(30(25,27-3)17-12-8-5-9-13-17)19-20(18(23-24-22)21(26-2)29-19)28-14-16-10-6-4-7-11-16/h4-13,15,18-21H,14H2,1-3H3/t15?,18-,19+,20-,21?,30?/m0/s1 |
| InChIKey | ZHLUYBARTFXVSN-MLJLCASVSA-N |
| XLogP | 4.26 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|