C33H22Cl2N4O7 — CID 151533822
2-[(2R,3R,4R,5R)-2-(benzoyloxymethyl)-4-(2-carboxyphenyl)-5-(2,6-dichloropurin-9-yl)-4-ethynyloxolan-3-yl]benzoic acid (PubChem CID 151533822) has the molecular formula C33H22Cl2N4O7 and a molecular weight of 657.47 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-2-(benzoyloxymethyl)-4-(2-carboxyphenyl)-5-(2,6-dichloropurin-9-yl)-4-ethynyloxolan-3-yl]benzoic acid.
| Compound Name | 2-[(2R,3R,4R,5R)-2-(benzoyloxymethyl)-4-(2-carboxyphenyl)-5-(2,6-dichloropurin-9-yl)-4-ethynyloxolan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 151533822 |
| Molecular Formula | C33H22Cl2N4O7 |
| Molecular Weight | 657.47 g/mol |
| Exact Mass | 656.09 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-2-(benzoyloxymethyl)-4-(2-carboxyphenyl)-5-(2,6-dichloropurin-9-yl)-4-ethynyloxolan-3-yl]benzoic acid |
| SMILES | C#C[C@@]1(c2ccccc2C(=O)O)[C@@H](c2ccccc2C(=O)O)[C@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C33H22Cl2N4O7/c1-2-33(22-15-9-8-14-21(22)29(42)43)24(19-12-6-7-13-20(19)28(40)41)23(16-45-30(44)18-10-4-3-5-11-18)46-31(33)39-17-36-25-26(34)37-32(35)38-27(25)39/h1,3-15,17,23-24,31H,16H2,(H,40,41)(H,42,43)/t23-,24-,31+,33+/m0/s1 |
| InChIKey | PXASWYMEIQAMGN-JMFKGVKBSA-N |
| XLogP | 5.64 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|