C14H12N2O3S — CID 151544387
1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-b]pyridin-4-one (PubChem CID 151544387) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-b]pyridin-4-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 151544387 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-b]pyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(=O)cc[nH]c32)cc1 |
| InChI | InChI=1S/C14H12N2O3S/c1-10-2-4-11(5-3-10)20(18,19)16-9-7-12-13(17)6-8-15-14(12)16/h2-9H,1H3,(H,15,17) |
| InChIKey | IYFZDPZYXVRGSD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |