C19H14ClN3O3S — CID 177335993
5-(6-chloro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-4-one (PubChem CID 177335993) has the molecular formula C19H14ClN3O3S and a molecular weight of 399.86 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 5-(6-chloro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 177335993 |
| Molecular Formula | C19H14ClN3O3S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(=O)n(-c4ccc(Cl)nc4)ccc32)cc1 |
| InChI | InChI=1S/C19H14ClN3O3S/c1-13-2-5-15(6-3-13)27(25,26)23-11-8-16-17(23)9-10-22(19(16)24)14-4-7-18(20)21-12-14/h2-12H,1H3 |
| InChIKey | YUOGUJFREAVHMI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|