C17H28N2O2 — CID 151618640
N-(3-tert-butylphenyl)-N'-hydroxy-4,4-dimethylpentanehydrazide (PubChem CID 151618640) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-N'-hydroxy-4,4-dimethylpentanehydrazide.
| Compound Name | N-(3-tert-butylphenyl)-N'-hydroxy-4,4-dimethylpentanehydrazide |
|---|---|
| PubChem CID | 151618640 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-(3-tert-butylphenyl)-N'-hydroxy-4,4-dimethylpentanehydrazide |
| SMILES | CC(C)(C)CCC(=O)N(NO)c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-16(2,3)11-10-15(20)19(18-21)14-9-7-8-13(12-14)17(4,5)6/h7-9,12,18,21H,10-11H2,1-6H3 |
| InChIKey | QOARPDQWMXTOBT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|