C17H11Cl2N3O3 — CID 151637109
5-[4-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-nitropyridine (PubChem CID 151637109) has the molecular formula C17H11Cl2N3O3 and a molecular weight of 376.20 g/mol. Its IUPAC name is 5-[4-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-nitropyridine.
| Compound Name | 5-[4-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-nitropyridine |
|---|---|
| PubChem CID | 151637109 |
| Molecular Formula | C17H11Cl2N3O3 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-[4-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(OCc3ccc(Cl)cc3Cl)ccn2)cn1 |
| InChI | InChI=1S/C17H11Cl2N3O3/c18-13-3-1-12(15(19)7-13)10-25-14-5-6-20-16(8-14)11-2-4-17(21-9-11)22(23)24/h1-9H,10H2 |
| InChIKey | QRSUTZKEKWQVBP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|