About CID 15163983
CID 15163983 (PubChem CID 15163983) has the molecular formula C17H6N14O16
and a molecular weight of 662.32 g/mol.
Molecular Properties
| Compound Name | CID 15163983 |
| PubChem CID | 15163983 |
| Molecular Formula | C17H6N14O16 |
| Molecular Weight | 662.32 g/mol |
| Exact Mass | 662.01 |
| IUPAC Name | — |
| SMILES | [N-]=[N+]=Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(Nc2nc(Nc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3[N+](=O)[O-])c([N+](=O)[O-])cc2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H6N14O16/c18-23-22-14-9(28(40)41)3-8(27(38)39)13(15(14)31(46)47)20-17-11(30(44)45)4-10(29(42)43)16(21-17)19-12-6(25(34)35)1-5(24(32)33)2-7(12)26(36)37/h1-4H,(H2,19,20,21) |
| InChIKey | SLGPFFONLDDCEH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 430.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 15163983 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15163983?
The IUPAC name of CID 15163983 (CID 15163983) is not available.
What is the SMILES notation for CID 15163983?
The canonical SMILES for CID 15163983 is [N-]=[N+]=Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(Nc2nc(Nc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3[N+](=O)[O-])c([N+](=O)[O-])cc2[N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of CID 15163983?
The InChIKey is SLGPFFONLDDCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H6N14O16/c18-23-22-14-9(28(40)41)3-8(27(38)39)13(15(14)31(46)47)20-17-11(30(44)45)4-10(29(42)43)16(21-17)19-12-6(25(34)35)1-5(24(32)33)2-7(12)26(36)37/h1-4H,(H2,19,20,21).
What are the key properties of CID 15163983?
CID 15163983 has a molecular weight of 662.32 g/mol, XLogP of 4.78, 13 rotatable bonds, 2 hydrogen bond donors, and 20 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15163983 is sourced from PubChem (CID 15163983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).