C6H4ClN3S — CID 151670347
6-chloro-2-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 151670347) has the molecular formula C6H4ClN3S and a molecular weight of 185.64 g/mol. Its IUPAC name is 6-chloro-2-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-chloro-2-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 151670347 |
| Molecular Formula | C6H4ClN3S |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 6-chloro-2-methyl-4-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1nc(=S)c(C#N)c(Cl)[nH]1 |
| InChI | InChI=1S/C6H4ClN3S/c1-3-9-5(7)4(2-8)6(11)10-3/h1H3,(H,9,10,11) |
| InChIKey | QYKJFIHKWOTVSI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|