About 2-iminopropanediamide
2-iminopropanediamide (PubChem CID 15168921) has the molecular formula C3H5N3O2
and a molecular weight of 115.09 g/mol. Its IUPAC name is 2-iminopropanediamide.
Molecular Properties
| Compound Name | 2-iminopropanediamide |
| PubChem CID | 15168921 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 2-iminopropanediamide |
| SMILES | [H]N=C(C(N)=O)C(N)=O |
| InChI | InChI=1S/C3H5N3O2/c4-1(2(5)7)3(6)8/h4H,(H2,5,7)(H2,6,8) |
| InChIKey | DPRLQYSTPKQKRP-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminopropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopropanediamide?
The IUPAC name of 2-iminopropanediamide (CID 15168921) is 2-iminopropanediamide.
What is the SMILES notation for 2-iminopropanediamide?
The canonical SMILES for 2-iminopropanediamide is [H]N=C(C(N)=O)C(N)=O.
What is the InChIKey of 2-iminopropanediamide?
The InChIKey is DPRLQYSTPKQKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2/c4-1(2(5)7)3(6)8/h4H,(H2,5,7)(H2,6,8).
What are the key properties of 2-iminopropanediamide?
2-iminopropanediamide has a molecular weight of 115.09 g/mol, XLogP of -2.02, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopropanediamide is sourced from PubChem (CID 15168921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).