C9H17BrMg — CID 151699481
magnesium;1,1,3-trimethylcyclohexane;bromide (PubChem CID 151699481) has the molecular formula C9H17BrMg and a molecular weight of 229.44 g/mol. Its IUPAC name is magnesium;1,1,3-trimethylcyclohexane;bromide.
| Compound Name | magnesium;1,1,3-trimethylcyclohexane;bromide |
|---|---|
| PubChem CID | 151699481 |
| Molecular Formula | C9H17BrMg |
| Molecular Weight | 229.44 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | magnesium;1,1,3-trimethylcyclohexane;bromide |
| SMILES | C[C-]1CCCC(C)(C)C1.[Br-].[Mg+2] |
| InChI | InChI=1S/C9H17.BrH.Mg/c1-8-5-4-6-9(2,3)7-8;;/h4-7H2,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | WFSVKYCICUZACG-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.44 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|