C18H22O2 — CID 151768924
2,4,5-trimethyl-6-(2,3,5-trimethylphenyl)benzene-1,3-diol (PubChem CID 151768924) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,4,5-trimethyl-6-(2,3,5-trimethylphenyl)benzene-1,3-diol.
| Compound Name | 2,4,5-trimethyl-6-(2,3,5-trimethylphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 151768924 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2,4,5-trimethyl-6-(2,3,5-trimethylphenyl)benzene-1,3-diol |
| SMILES | Cc1cc(C)c(C)c(-c2c(C)c(C)c(O)c(C)c2O)c1 |
| InChI | InChI=1S/C18H22O2/c1-9-7-10(2)11(3)15(8-9)16-12(4)13(5)17(19)14(6)18(16)20/h7-8,19-20H,1-6H3 |
| InChIKey | RSEKJPPYLBJINE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |