C7H5NS — CID 151859345
5-sulfanylidenecyclohexa-1,3-diene-1-carbonitrile (PubChem CID 151859345) has the molecular formula C7H5NS and a molecular weight of 135.19 g/mol. Its IUPAC name is 5-sulfanylidenecyclohexa-1,3-diene-1-carbonitrile.
| Compound Name | 5-sulfanylidenecyclohexa-1,3-diene-1-carbonitrile |
|---|---|
| PubChem CID | 151859345 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 5-sulfanylidenecyclohexa-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=CC=CC(=S)C1 |
| InChI | InChI=1S/C7H5NS/c8-5-6-2-1-3-7(9)4-6/h1-3H,4H2 |
| InChIKey | SKJUCHCQFGIBDI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|