C20H29NO6 — CID 15192447
triethyl (4aS,7Z,10aS)-4a,5,6,9,10,10a-hexahydro-2H-cycloocta[c]pyridine-1,1,4-tricarboxylate (PubChem CID 15192447) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is triethyl (4aS,7Z,10aS)-4a,5,6,9,10,10a-hexahydro-2H-cycloocta[c]pyridine-1,1,4-tricarboxylate.
| Compound Name | triethyl (4aS,7Z,10aS)-4a,5,6,9,10,10a-hexahydro-2H-cycloocta[c]pyridine-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 15192447 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | triethyl (4aS,7Z,10aS)-4a,5,6,9,10,10a-hexahydro-2H-cycloocta[c]pyridine-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)C1=CNC(C(=O)OCC)(C(=O)OCC)[C@H]2CC/C=C\CC[C@H]12 |
| InChI | InChI=1S/C20H29NO6/c1-4-25-17(22)15-13-21-20(18(23)26-5-2,19(24)27-6-3)16-12-10-8-7-9-11-14(15)16/h7-8,13-14,16,21H,4-6,9-12H2,1-3H3/b8-7-/t14-,16+/m1/s1 |
| InChIKey | PPDLVMMPLQNTRB-VYNKOYMISA-N |
| XLogP | 2.26 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|