C17H24O4 — CID 11087619
diethyl (3Z)-3-ethylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate (PubChem CID 11087619) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is diethyl (3Z)-3-ethylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | diethyl (3Z)-3-ethylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11087619 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | diethyl (3Z)-3-ethylidene-3a,6,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C/C=C1/CC(C(=O)OCC)(C(=O)OCC)C2CCC=CC12 |
| InChI | InChI=1S/C17H24O4/c1-4-12-11-17(15(18)20-5-2,16(19)21-6-3)14-10-8-7-9-13(12)14/h4,7,9,13-14H,5-6,8,10-11H2,1-3H3/b12-4- |
| InChIKey | WPXZJORXWPHVIZ-QCDXTXTGSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|