C26H26N4O — CID 151942382
2-(4-benzylpiperidin-1-yl)-N-pyridin-4-yl-1H-indole-5-carboxamide (PubChem CID 151942382) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-pyridin-4-yl-1H-indole-5-carboxamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-pyridin-4-yl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 151942382 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-pyridin-4-yl-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1ccc2[nH]c(N3CCC(Cc4ccccc4)CC3)cc2c1 |
| InChI | InChI=1S/C26H26N4O/c31-26(28-23-8-12-27-13-9-23)21-6-7-24-22(17-21)18-25(29-24)30-14-10-20(11-15-30)16-19-4-2-1-3-5-19/h1-9,12-13,17-18,20,29H,10-11,14-16H2,(H,27,28,31) |
| InChIKey | TUYIOUWXCSWPID-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |