C19H20F3N3OS — CID 151988589
4-[[4-[3-(trifluoromethyl)phenyl]thiomorpholin-3-yl]methyl]benzohydrazide (PubChem CID 151988589) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is 4-[[4-[3-(trifluoromethyl)phenyl]thiomorpholin-3-yl]methyl]benzohydrazide.
| Compound Name | 4-[[4-[3-(trifluoromethyl)phenyl]thiomorpholin-3-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 151988589 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[[4-[3-(trifluoromethyl)phenyl]thiomorpholin-3-yl]methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(CC2CSCCN2c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F3N3OS/c20-19(21,22)15-2-1-3-16(11-15)25-8-9-27-12-17(25)10-13-4-6-14(7-5-13)18(26)24-23/h1-7,11,17H,8-10,12,23H2,(H,24,26) |
| InChIKey | UEEMWAWRUMEFBX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|