C11H3F19O — CID 15210906
1,1,1,4,4,5,5,5-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)-2-(trifluoromethyl)pent-2-ene (PubChem CID 15210906) has the molecular formula C11H3F19O and a molecular weight of 512.11 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 15210906 |
| Molecular Formula | C11H3F19O |
| Molecular Weight | 512.11 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)-2-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H3F19O/c12-4(13)7(18,19)10(26,27)5(14,15)1-31-3(6(16,17)11(28,29)30)2(8(20,21)22)9(23,24)25/h4H,1H2 |
| InChIKey | CXUIPQMFHUWBEE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.11 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|