C21H17F3N2 — CID 15212041
2-(4-butyl-3,5,6-trifluoro-2-pyridinyl)-2-naphthalen-1-ylacetonitrile (PubChem CID 15212041) has the molecular formula C21H17F3N2 and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-(4-butyl-3,5,6-trifluoro-2-pyridinyl)-2-naphthalen-1-ylacetonitrile.
| Compound Name | 2-(4-butyl-3,5,6-trifluoro-2-pyridinyl)-2-naphthalen-1-ylacetonitrile |
|---|---|
| PubChem CID | 15212041 |
| Molecular Formula | C21H17F3N2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(4-butyl-3,5,6-trifluoro-2-pyridinyl)-2-naphthalen-1-ylacetonitrile |
| SMILES | CCCCc1c(F)c(F)nc(C(C#N)c2cccc3ccccc23)c1F |
| InChI | InChI=1S/C21H17F3N2/c1-2-3-9-16-18(22)20(26-21(24)19(16)23)17(12-25)15-11-6-8-13-7-4-5-10-14(13)15/h4-8,10-11,17H,2-3,9H2,1H3 |
| InChIKey | VOVGOCKGABBXKW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|