C18H23N3O11 — CID 15236524
2-[5-amino-2-(carboxymethoxy)phenyl]-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 15236524) has the molecular formula C18H23N3O11 and a molecular weight of 457.39 g/mol. Its IUPAC name is 2-[5-amino-2-(carboxymethoxy)phenyl]-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[5-amino-2-(carboxymethoxy)phenyl]-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 15236524 |
| Molecular Formula | C18H23N3O11 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-[5-amino-2-(carboxymethoxy)phenyl]-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | Nc1ccc(OCC(=O)O)c(C(C(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C18H23N3O11/c19-10-1-2-12(32-9-16(28)29)11(5-10)17(18(30)31)21(8-15(26)27)4-3-20(6-13(22)23)7-14(24)25/h1-2,5,17H,3-4,6-9,19H2,(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | LRMOAWFXKYJJGN-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|