C9H15NO — CID 15249741
10-oxido-10-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 15249741) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 10-oxido-10-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | 10-oxido-10-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 15249741 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 10-oxido-10-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | [O-][N+]12C3CCC1CCC2CC3 |
| InChI | InChI=1S/C9H15NO/c11-10-7-1-2-8(10)5-6-9(10)4-3-7/h7-9H,1-6H2 |
| InChIKey | YZJDUVGICGDPBJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|