C24H30O4 — CID 15252540
dimethyl 4-tert-butyl-2,6,11,12-tetramethyltricyclo[6.2.2.01,7]dodeca-2,4,6,9,11-pentaene-9,10-dicarboxylate (PubChem CID 15252540) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is dimethyl 4-tert-butyl-2,6,11,12-tetramethyltricyclo[6.2.2.01,7]dodeca-2,4,6,9,11-pentaene-9,10-dicarboxylate.
| Compound Name | dimethyl 4-tert-butyl-2,6,11,12-tetramethyltricyclo[6.2.2.01,7]dodeca-2,4,6,9,11-pentaene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 15252540 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | dimethyl 4-tert-butyl-2,6,11,12-tetramethyltricyclo[6.2.2.01,7]dodeca-2,4,6,9,11-pentaene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C23C(C)=CC(C(C)(C)C)=CC(C)=C2C1C(C)=C3C |
| InChI | InChI=1S/C24H30O4/c1-12-10-16(23(5,6)7)11-13(2)24-15(4)14(3)17(19(12)24)18(21(25)27-8)20(24)22(26)28-9/h10-11,17H,1-9H3 |
| InChIKey | UVDAFWNSMQHZTD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|