About 4-methylidenehepta-2,5-dienedinitrile
4-methylidenehepta-2,5-dienedinitrile (PubChem CID 152631146) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4-methylidenehepta-2,5-dienedinitrile.
Molecular Properties
| Compound Name | 4-methylidenehepta-2,5-dienedinitrile |
| PubChem CID | 152631146 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 4-methylidenehepta-2,5-dienedinitrile |
| SMILES | C=C(C=CC#N)C=CC#N |
| InChI | InChI=1S/C8H6N2/c1-8(4-2-6-9)5-3-7-10/h2-5H,1H2 |
| InChIKey | ZDOAQOGFGZDGQU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidenehepta-2,5-dienedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidenehepta-2,5-dienedinitrile?
The IUPAC name of 4-methylidenehepta-2,5-dienedinitrile (CID 152631146) is 4-methylidenehepta-2,5-dienedinitrile.
What is the SMILES notation for 4-methylidenehepta-2,5-dienedinitrile?
The canonical SMILES for 4-methylidenehepta-2,5-dienedinitrile is C=C(C=CC#N)C=CC#N.
What is the InChIKey of 4-methylidenehepta-2,5-dienedinitrile?
The InChIKey is ZDOAQOGFGZDGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-8(4-2-6-9)5-3-7-10/h2-5H,1H2.
What are the key properties of 4-methylidenehepta-2,5-dienedinitrile?
4-methylidenehepta-2,5-dienedinitrile has a molecular weight of 130.15 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidenehepta-2,5-dienedinitrile is sourced from PubChem (CID 152631146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).