About potassium (Z)-3-cyanoprop-2-enoate
potassium (Z)-3-cyanoprop-2-enoate (PubChem CID 140761253) has the molecular formula C4H2KNO2
and a molecular weight of 135.16 g/mol. Its IUPAC name is potassium (Z)-3-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | potassium (Z)-3-cyanoprop-2-enoate |
| PubChem CID | 140761253 |
| Molecular Formula | C4H2KNO2 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 134.97 |
| IUPAC Name | potassium (Z)-3-cyanoprop-2-enoate |
| SMILES | N#C/C=C\C(=O)[O-].[K+] |
| InChI | InChI=1S/C4H3NO2.K/c5-3-1-2-4(6)7;/h1-2H,(H,6,7);/q;+1/p-1/b2-1-; |
| InChIKey | QFDZGTSKVCJBIB-ODZAUARKSA-M |
| XLogP | -4.18 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium (Z)-3-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (Z)-3-cyanoprop-2-enoate?
The IUPAC name of potassium (Z)-3-cyanoprop-2-enoate (CID 140761253) is potassium (Z)-3-cyanoprop-2-enoate.
What is the SMILES notation for potassium (Z)-3-cyanoprop-2-enoate?
The canonical SMILES for potassium (Z)-3-cyanoprop-2-enoate is N#C/C=C\C(=O)[O-].[K+].
What is the InChIKey of potassium (Z)-3-cyanoprop-2-enoate?
The InChIKey is QFDZGTSKVCJBIB-ODZAUARKSA-M. The full InChI is InChI=1S/C4H3NO2.K/c5-3-1-2-4(6)7;/h1-2H,(H,6,7);/q;+1/p-1/b2-1-;.
What are the key properties of potassium (Z)-3-cyanoprop-2-enoate?
potassium (Z)-3-cyanoprop-2-enoate has a molecular weight of 135.16 g/mol, XLogP of -4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (Z)-3-cyanoprop-2-enoate is sourced from PubChem (CID 140761253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).