C11H10ClFN2O2 — CID 152639429
methyl 2-(5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)-2-fluoroacetate (PubChem CID 152639429) has the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. Its IUPAC name is methyl 2-(5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)-2-fluoroacetate.
| Compound Name | methyl 2-(5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 152639429 |
| Molecular Formula | C11H10ClFN2O2 |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | methyl 2-(5-chloro-7-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)-2-fluoroacetate |
| SMILES | COC(=O)C(F)c1c[nH]c2c(C)cc(Cl)nc12 |
| InChI | InChI=1S/C11H10ClFN2O2/c1-5-3-7(12)15-10-6(4-14-9(5)10)8(13)11(16)17-2/h3-4,8,14H,1-2H3 |
| InChIKey | ZFFTVGUDEPPRHL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|