C14H9F3N2OS — CID 15264835
S-[(Z)-(1-dibenzofuran-2-yl-2,2,2-trifluoroethylidene)amino]thiohydroxylamine (PubChem CID 15264835) has the molecular formula C14H9F3N2OS and a molecular weight of 310.30 g/mol. Its IUPAC name is S-[(Z)-(1-dibenzofuran-2-yl-2,2,2-trifluoroethylidene)amino]thiohydroxylamine.
| Compound Name | S-[(Z)-(1-dibenzofuran-2-yl-2,2,2-trifluoroethylidene)amino]thiohydroxylamine |
|---|---|
| PubChem CID | 15264835 |
| Molecular Formula | C14H9F3N2OS |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | S-[(Z)-(1-dibenzofuran-2-yl-2,2,2-trifluoroethylidene)amino]thiohydroxylamine |
| SMILES | NS/N=C(/c1ccc2oc3ccccc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C14H9F3N2OS/c15-14(16,17)13(19-21-18)8-5-6-12-10(7-8)9-3-1-2-4-11(9)20-12/h1-7H,18H2/b19-13- |
| InChIKey | IUOOZJPHJAYHJP-UYRXBGFRSA-N |
| XLogP | 4.46 |
| TPSA | 51.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|