C13H16F2NOTi- — CID 152656325
N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpentanamide;titanium (PubChem CID 152656325) has the molecular formula C13H16F2NOTi- and a molecular weight of 288.14 g/mol. Its IUPAC name is N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpentanamide;titanium.
| Compound Name | N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpentanamide;titanium |
|---|---|
| PubChem CID | 152656325 |
| Molecular Formula | C13H16F2NOTi- |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(2,4-difluorobenzene-3-id-1-yl)-2,2-dimethylpentanamide;titanium |
| SMILES | CCCC(C)(C)C(=O)Nc1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C13H16F2NO.Ti/c1-4-7-13(2,3)12(17)16-11-6-5-9(14)8-10(11)15;/h5-6H,4,7H2,1-3H3,(H,16,17);/q-1; |
| InChIKey | SCBPIJBSWMEYQF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|