C22H24F4N2S2Ti — CID 158806403
bis(N-(2,4-difluorobenzene-3-id-1-yl)pentanethioamide);titanium(2+) (PubChem CID 158806403) has the molecular formula C22H24F4N2S2Ti and a molecular weight of 504.44 g/mol. Its IUPAC name is bis(N-(2,4-difluorobenzene-3-id-1-yl)pentanethioamide);titanium(2+).
| Compound Name | bis(N-(2,4-difluorobenzene-3-id-1-yl)pentanethioamide);titanium(2+) |
|---|---|
| PubChem CID | 158806403 |
| Molecular Formula | C22H24F4N2S2Ti |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | bis(N-(2,4-difluorobenzene-3-id-1-yl)pentanethioamide);titanium(2+) |
| SMILES | CCCCC(=S)Nc1ccc(F)[c-]c1F.CCCCC(=S)Nc1ccc(F)[c-]c1F.[Ti+2] |
| InChI | InChI=1S/2C11H12F2NS.Ti/c2*1-2-3-4-11(15)14-10-6-5-8(12)7-9(10)13;/h2*5-6H,2-4H2,1H3,(H,14,15);/q2*-1;+2 |
| InChIKey | IXCFRIXRNSDHFZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|