C8H17O8P — CID 15265948
[(1S,2S,4S,6S)-2,4-dihydroxy-6-(2-hydroxyethoxy)cyclohexyl] dihydrogen phosphate (PubChem CID 15265948) has the molecular formula C8H17O8P and a molecular weight of 272.19 g/mol. Its IUPAC name is [(1S,2S,4S,6S)-2,4-dihydroxy-6-(2-hydroxyethoxy)cyclohexyl] dihydrogen phosphate.
| Compound Name | [(1S,2S,4S,6S)-2,4-dihydroxy-6-(2-hydroxyethoxy)cyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15265948 |
| Molecular Formula | C8H17O8P |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [(1S,2S,4S,6S)-2,4-dihydroxy-6-(2-hydroxyethoxy)cyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@@H]1[C@@H](OCCO)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C8H17O8P/c9-1-2-15-7-4-5(10)3-6(11)8(7)16-17(12,13)14/h5-11H,1-4H2,(H2,12,13,14)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | AQOMOKLTJWIJLJ-XAMCCFCMSA-N |
| XLogP | -1.64 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|