C17H24N2O5 — CID 152696578
2-(4-acetyl-3-amino-2,6-dimethoxy-N-methylanilino)ethyl 2-methylprop-2-enoate (PubChem CID 152696578) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(4-acetyl-3-amino-2,6-dimethoxy-N-methylanilino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-acetyl-3-amino-2,6-dimethoxy-N-methylanilino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 152696578 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-(4-acetyl-3-amino-2,6-dimethoxy-N-methylanilino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)c1c(OC)cc(C(C)=O)c(N)c1OC |
| InChI | InChI=1S/C17H24N2O5/c1-10(2)17(21)24-8-7-19(4)15-13(22-5)9-12(11(3)20)14(18)16(15)23-6/h9H,1,7-8,18H2,2-6H3 |
| InChIKey | ZQRIUGDKWXUMHP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|