C16H21NO5 — CID 153304874
2-[4-acetyl-3-amino-2-(hydroxymethyl)-6-methoxyphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 153304874) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[4-acetyl-3-amino-2-(hydroxymethyl)-6-methoxyphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-acetyl-3-amino-2-(hydroxymethyl)-6-methoxyphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153304874 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[4-acetyl-3-amino-2-(hydroxymethyl)-6-methoxyphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1c(OC)cc(C(C)=O)c(N)c1CO |
| InChI | InChI=1S/C16H21NO5/c1-9(2)16(20)22-6-5-11-13(8-18)15(17)12(10(3)19)7-14(11)21-4/h7,18H,1,5-6,8,17H2,2-4H3 |
| InChIKey | LAYUYGSQRSQNIN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|