C34H27Cl4OP — CID 152728303
1,3-dichloro-2-[[[(2,6-dichlorophenyl)-phenylmethyl]-(2,5-dimethylphenyl)phosphoryl]-phenylmethyl]benzene (PubChem CID 152728303) has the molecular formula C34H27Cl4OP and a molecular weight of 624.38 g/mol. Its IUPAC name is 1,3-dichloro-2-[[[(2,6-dichlorophenyl)-phenylmethyl]-(2,5-dimethylphenyl)phosphoryl]-phenylmethyl]benzene.
| Compound Name | 1,3-dichloro-2-[[[(2,6-dichlorophenyl)-phenylmethyl]-(2,5-dimethylphenyl)phosphoryl]-phenylmethyl]benzene |
|---|---|
| PubChem CID | 152728303 |
| Molecular Formula | C34H27Cl4OP |
| Molecular Weight | 624.38 g/mol |
| Exact Mass | 622.06 |
| IUPAC Name | 1,3-dichloro-2-[[[(2,6-dichlorophenyl)-phenylmethyl]-(2,5-dimethylphenyl)phosphoryl]-phenylmethyl]benzene |
| SMILES | Cc1ccc(C)c(P(=O)(C(c2ccccc2)c2c(Cl)cccc2Cl)C(c2ccccc2)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C34H27Cl4OP/c1-22-19-20-23(2)30(21-22)40(39,33(24-11-5-3-6-12-24)31-26(35)15-9-16-27(31)36)34(25-13-7-4-8-14-25)32-28(37)17-10-18-29(32)38/h3-21,33-34H,1-2H3 |
| InChIKey | ZXBLJCIVKUDFEI-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.38 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|