C17H32 — CID 152731063
7,7-bis(ethenyl)-3-ethylundecane (PubChem CID 152731063) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 7,7-bis(ethenyl)-3-ethylundecane.
| Compound Name | 7,7-bis(ethenyl)-3-ethylundecane |
|---|---|
| PubChem CID | 152731063 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 7,7-bis(ethenyl)-3-ethylundecane |
| SMILES | C=CC(C=C)(CCCC)CCCC(CC)CC |
| InChI | InChI=1S/C17H32/c1-6-11-14-17(9-4,10-5)15-12-13-16(7-2)8-3/h9-10,16H,4-8,11-15H2,1-3H3 |
| InChIKey | ZXQCRENLNJOQPW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|